commit 14735bd9a5cf626e6e9de4b1a94b3737c0b50eed Author: Gregory Ballantine Date: Sat Jul 9 12:25:26 2022 -0400 Initial project structure with Slim skeleton diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000..63066a6 --- /dev/null +++ b/.gitignore @@ -0,0 +1,7 @@ +.idea/ +.vscode/ +/coverage/ +/vendor/ +/logs/* +!/logs/README.md +.phpunit.result.cache diff --git a/.htaccess b/.htaccess new file mode 100644 index 0000000..c7552bf --- /dev/null +++ b/.htaccess @@ -0,0 +1,19 @@ +Options All -Indexes + + +order allow,deny +deny from all + + + + # Redirect to the public folder + RewriteEngine On + # RewriteBase / + RewriteRule ^$ public/ [L] + RewriteRule (.*) public/$1 [L] + + # Redirect to HTTPS + # RewriteEngine On + # RewriteCond %{HTTPS} off + # RewriteRule ^(.*)$ https://%{HTTP_HOST}%{REQUEST_URI} [L,R=301] + diff --git a/CONTRIBUTING.md b/CONTRIBUTING.md new file mode 100644 index 0000000..1c7a3e3 --- /dev/null +++ b/CONTRIBUTING.md @@ -0,0 +1,14 @@ +# How to Contribute + +## Pull Requests + +1. Fork the Slim Skeleton repository +2. Create a new branch for each feature or improvement +3. Send a pull request from each feature branch to the **4.x** branch + +It is very important to separate new features or improvements into separate feature branches, and to send a +pull request for each branch. This allows us to review and pull in new features or improvements individually. + +## Style Guide + +All pull requests must adhere to the [PSR-2 standard](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-2-coding-style-guide.md). diff --git a/README.md b/README.md new file mode 100644 index 0000000..5354367 --- /dev/null +++ b/README.md @@ -0,0 +1,42 @@ +# Slim Framework 4 Skeleton Application + +[![Coverage Status](https://coveralls.io/repos/github/slimphp/Slim-Skeleton/badge.svg?branch=master)](https://coveralls.io/github/slimphp/Slim-Skeleton?branch=master) + +Use this skeleton application to quickly setup and start working on a new Slim Framework 4 application. This application uses the latest Slim 4 with Slim PSR-7 implementation and PHP-DI container implementation. It also uses the Monolog logger. + +This skeleton application was built for Composer. This makes setting up a new Slim Framework application quick and easy. + +## Install the Application + +Run this command from the directory in which you want to install your new Slim Framework application. You will require PHP 7.3 or newer. + +```bash +composer create-project slim/slim-skeleton [my-app-name] +``` + +Replace `[my-app-name]` with the desired directory name for your new application. You'll want to: + +* Point your virtual host document root to your new application's `public/` directory. +* Ensure `logs/` is web writable. + +To run the application in development, you can run these commands + +```bash +cd [my-app-name] +composer start +``` + +Or you can use `docker-compose` to run the app with `docker`, so you can run these commands: +```bash +cd [my-app-name] +docker-compose up -d +``` +After that, open `http://localhost:8080` in your browser. + +Run this command in the application directory to run the test suite + +```bash +composer test +``` + +That's it! Now go build something cool. diff --git a/app/dependencies.php b/app/dependencies.php new file mode 100644 index 0000000..9a948b5 --- /dev/null +++ b/app/dependencies.php @@ -0,0 +1,29 @@ +addDefinitions([ + LoggerInterface::class => function (ContainerInterface $c) { + $settings = $c->get(SettingsInterface::class); + + $loggerSettings = $settings->get('logger'); + $logger = new Logger($loggerSettings['name']); + + $processor = new UidProcessor(); + $logger->pushProcessor($processor); + + $handler = new StreamHandler($loggerSettings['path'], $loggerSettings['level']); + $logger->pushHandler($handler); + + return $logger; + }, + ]); +}; diff --git a/app/middleware.php b/app/middleware.php new file mode 100644 index 0000000..20c8980 --- /dev/null +++ b/app/middleware.php @@ -0,0 +1,9 @@ +add(SessionMiddleware::class); +}; diff --git a/app/repositories.php b/app/repositories.php new file mode 100644 index 0000000..62a58f3 --- /dev/null +++ b/app/repositories.php @@ -0,0 +1,13 @@ +addDefinitions([ + UserRepository::class => \DI\autowire(InMemoryUserRepository::class), + ]); +}; diff --git a/app/routes.php b/app/routes.php new file mode 100644 index 0000000..d4a2fff --- /dev/null +++ b/app/routes.php @@ -0,0 +1,26 @@ +options('/{routes:.*}', function (Request $request, Response $response) { + // CORS Pre-Flight OPTIONS Request Handler + return $response; + }); + + $app->get('/', function (Request $request, Response $response) { + $response->getBody()->write('Hello world!'); + return $response; + }); + + $app->group('/users', function (Group $group) { + $group->get('', ListUsersAction::class); + $group->get('/{id}', ViewUserAction::class); + }); +}; diff --git a/app/settings.php b/app/settings.php new file mode 100644 index 0000000..016abd7 --- /dev/null +++ b/app/settings.php @@ -0,0 +1,26 @@ +addDefinitions([ + SettingsInterface::class => function () { + return new Settings([ + 'displayErrorDetails' => true, // Should be set to false in production + 'logError' => false, + 'logErrorDetails' => false, + 'logger' => [ + 'name' => 'slim-app', + 'path' => isset($_ENV['docker']) ? 'php://stdout' : __DIR__ . '/../logs/app.log', + 'level' => Logger::DEBUG, + ], + ]); + } + ]); +}; diff --git a/composer.json b/composer.json new file mode 100644 index 0000000..1017f09 --- /dev/null +++ b/composer.json @@ -0,0 +1,58 @@ +{ + "name": "slim/slim-skeleton", + "description": "A Slim Framework skeleton application for rapid development", + "keywords": [ + "microframework", + "rest", + "router", + "psr7" + ], + "homepage": "http://github.com/slimphp/Slim-Skeleton", + "license": "MIT", + "authors": [ + { + "name": "Josh Lockhart", + "email": "info@joshlockhart.com", + "homepage": "http://www.joshlockhart.com/" + }, + { + "name": "Pierre Berube", + "email": "pierre@lgse.com", + "homepage": "http://www.lgse.com/" + } + ], + "require": { + "php": "^7.4 || ^8.0", + "ext-json": "*", + "monolog/monolog": "^2.3", + "php-di/php-di": "^6.3", + "slim/psr7": "^1.5", + "slim/slim": "^4.9" + }, + "require-dev": { + "jangregor/phpstan-prophecy": "^1.0.0", + "phpspec/prophecy-phpunit": "^2.0", + "phpstan/extension-installer": "^1.1.0", + "phpstan/phpstan": "^1.3", + "phpunit/phpunit": "^9.5.11", + "squizlabs/php_codesniffer": "^3.6" + }, + "config": { + "process-timeout": 0, + "sort-packages": true + }, + "autoload": { + "psr-4": { + "App\\": "src/" + } + }, + "autoload-dev": { + "psr-4": { + "Tests\\": "tests/" + } + }, + "scripts": { + "start": "php -S localhost:8080 -t public", + "test": "phpunit" + } +} diff --git a/composer.lock b/composer.lock new file mode 100644 index 0000000..dcb27b4 --- /dev/null +++ b/composer.lock @@ -0,0 +1,3401 @@ +{ + "_readme": [ + "This file locks the dependencies of your project to a known state", + "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies", + "This file is @generated automatically" + ], + "content-hash": "15c8f3e0c1caa0ccc80e3b18ec1bf2cb", + "packages": [ + { + "name": "fig/http-message-util", + "version": "1.1.5", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-message-util.git", + "reference": "9d94dc0154230ac39e5bf89398b324a86f63f765" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-message-util/zipball/9d94dc0154230ac39e5bf89398b324a86f63f765", + "reference": "9d94dc0154230ac39e5bf89398b324a86f63f765", + "shasum": "" + }, + "require": { + "php": "^5.3 || ^7.0 || ^8.0" + }, + "suggest": { + "psr/http-message": "The package containing the PSR-7 interfaces" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Fig\\Http\\Message\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Utility classes and constants for use with PSR-7 (psr/http-message)", + "keywords": [ + "http", + "http-message", + "psr", + "psr-7", + "request", + "response" + ], + "support": { + "issues": "https://github.com/php-fig/http-message-util/issues", + "source": "https://github.com/php-fig/http-message-util/tree/1.1.5" + }, + "time": "2020-11-24T22:02:12+00:00" + }, + { + "name": "laravel/serializable-closure", + "version": "v1.2.0", + "source": { + "type": "git", + "url": "https://github.com/laravel/serializable-closure.git", + "reference": "09f0e9fb61829f628205b7c94906c28740ff9540" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/laravel/serializable-closure/zipball/09f0e9fb61829f628205b7c94906c28740ff9540", + "reference": "09f0e9fb61829f628205b7c94906c28740ff9540", + "shasum": "" + }, + "require": { + "php": "^7.3|^8.0" + }, + "require-dev": { + "pestphp/pest": "^1.18", + "phpstan/phpstan": "^0.12.98", + "symfony/var-dumper": "^5.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Laravel\\SerializableClosure\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Taylor Otwell", + "email": "taylor@laravel.com" + }, + { + "name": "Nuno Maduro", + "email": "nuno@laravel.com" + } + ], + "description": "Laravel Serializable Closure provides an easy and secure way to serialize closures in PHP.", + "keywords": [ + "closure", + "laravel", + "serializable" + ], + "support": { + "issues": "https://github.com/laravel/serializable-closure/issues", + "source": "https://github.com/laravel/serializable-closure" + }, + "time": "2022-05-16T17:09:47+00:00" + }, + { + "name": "monolog/monolog", + "version": "2.7.0", + "source": { + "type": "git", + "url": "https://github.com/Seldaek/monolog.git", + "reference": "5579edf28aee1190a798bfa5be8bc16c563bd524" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/Seldaek/monolog/zipball/5579edf28aee1190a798bfa5be8bc16c563bd524", + "reference": "5579edf28aee1190a798bfa5be8bc16c563bd524", + "shasum": "" + }, + "require": { + "php": ">=7.2", + "psr/log": "^1.0.1 || ^2.0 || ^3.0" + }, + "provide": { + "psr/log-implementation": "1.0.0 || 2.0.0 || 3.0.0" + }, + "require-dev": { + "aws/aws-sdk-php": "^2.4.9 || ^3.0", + "doctrine/couchdb": "~1.0@dev", + "elasticsearch/elasticsearch": "^7 || ^8", + "ext-json": "*", + "graylog2/gelf-php": "^1.4.2", + "guzzlehttp/guzzle": "^7.4", + "guzzlehttp/psr7": "^2.2", + "mongodb/mongodb": "^1.8", + "php-amqplib/php-amqplib": "~2.4 || ^3", + "php-console/php-console": "^3.1.3", + "phpspec/prophecy": "^1.15", + "phpstan/phpstan": "^0.12.91", + "phpunit/phpunit": "^8.5.14", + "predis/predis": "^1.1", + "rollbar/rollbar": "^1.3 || ^2 || ^3", + "ruflin/elastica": "^7", + "swiftmailer/swiftmailer": "^5.3|^6.0", + "symfony/mailer": "^5.4 || ^6", + "symfony/mime": "^5.4 || ^6" + }, + "suggest": { + "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB", + "doctrine/couchdb": "Allow sending log messages to a CouchDB server", + "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client", + "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)", + "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler", + "ext-mbstring": "Allow to work properly with unicode symbols", + "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)", + "ext-openssl": "Required to send log messages using SSL", + "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)", + "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server", + "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)", + "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib", + "php-console/php-console": "Allow sending log messages to Google Chrome", + "rollbar/rollbar": "Allow sending log messages to Rollbar", + "ruflin/elastica": "Allow sending log messages to an Elastic Search server" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "2.x-dev" + } + }, + "autoload": { + "psr-4": { + "Monolog\\": "src/Monolog" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jordi Boggiano", + "email": "j.boggiano@seld.be", + "homepage": "https://seld.be" + } + ], + "description": "Sends your logs to files, sockets, inboxes, databases and various web services", + "homepage": "https://github.com/Seldaek/monolog", + "keywords": [ + "log", + "logging", + "psr-3" + ], + "support": { + "issues": "https://github.com/Seldaek/monolog/issues", + "source": "https://github.com/Seldaek/monolog/tree/2.7.0" + }, + "funding": [ + { + "url": "https://github.com/Seldaek", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/monolog/monolog", + "type": "tidelift" + } + ], + "time": "2022-06-09T08:59:12+00:00" + }, + { + "name": "nikic/fast-route", + "version": "v1.3.0", + "source": { + "type": "git", + "url": "https://github.com/nikic/FastRoute.git", + "reference": "181d480e08d9476e61381e04a71b34dc0432e812" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nikic/FastRoute/zipball/181d480e08d9476e61381e04a71b34dc0432e812", + "reference": "181d480e08d9476e61381e04a71b34dc0432e812", + "shasum": "" + }, + "require": { + "php": ">=5.4.0" + }, + "require-dev": { + "phpunit/phpunit": "^4.8.35|~5.7" + }, + "type": "library", + "autoload": { + "files": [ + "src/functions.php" + ], + "psr-4": { + "FastRoute\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Nikita Popov", + "email": "nikic@php.net" + } + ], + "description": "Fast request router for PHP", + "keywords": [ + "router", + "routing" + ], + "support": { + "issues": "https://github.com/nikic/FastRoute/issues", + "source": "https://github.com/nikic/FastRoute/tree/master" + }, + "time": "2018-02-13T20:26:39+00:00" + }, + { + "name": "php-di/invoker", + "version": "2.3.3", + "source": { + "type": "git", + "url": "https://github.com/PHP-DI/Invoker.git", + "reference": "cd6d9f267d1a3474bdddf1be1da079f01b942786" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/PHP-DI/Invoker/zipball/cd6d9f267d1a3474bdddf1be1da079f01b942786", + "reference": "cd6d9f267d1a3474bdddf1be1da079f01b942786", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "psr/container": "^1.0|^2.0" + }, + "require-dev": { + "athletic/athletic": "~0.1.8", + "mnapoli/hard-mode": "~0.3.0", + "phpunit/phpunit": "^9.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Invoker\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Generic and extensible callable invoker", + "homepage": "https://github.com/PHP-DI/Invoker", + "keywords": [ + "callable", + "dependency", + "dependency-injection", + "injection", + "invoke", + "invoker" + ], + "support": { + "issues": "https://github.com/PHP-DI/Invoker/issues", + "source": "https://github.com/PHP-DI/Invoker/tree/2.3.3" + }, + "funding": [ + { + "url": "https://github.com/mnapoli", + "type": "github" + } + ], + "time": "2021-12-13T09:22:56+00:00" + }, + { + "name": "php-di/php-di", + "version": "6.4.0", + "source": { + "type": "git", + "url": "https://github.com/PHP-DI/PHP-DI.git", + "reference": "ae0f1b3b03d8b29dff81747063cbfd6276246cc4" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/PHP-DI/PHP-DI/zipball/ae0f1b3b03d8b29dff81747063cbfd6276246cc4", + "reference": "ae0f1b3b03d8b29dff81747063cbfd6276246cc4", + "shasum": "" + }, + "require": { + "laravel/serializable-closure": "^1.0", + "php": ">=7.4.0", + "php-di/invoker": "^2.0", + "php-di/phpdoc-reader": "^2.0.1", + "psr/container": "^1.0" + }, + "provide": { + "psr/container-implementation": "^1.0" + }, + "require-dev": { + "doctrine/annotations": "~1.10", + "friendsofphp/php-cs-fixer": "^2.4", + "mnapoli/phpunit-easymock": "^1.2", + "ocramius/proxy-manager": "^2.11.2", + "phpstan/phpstan": "^0.12", + "phpunit/phpunit": "^9.5" + }, + "suggest": { + "doctrine/annotations": "Install it if you want to use annotations (version ~1.2)", + "ocramius/proxy-manager": "Install it if you want to use lazy injection (version ~2.0)" + }, + "type": "library", + "autoload": { + "files": [ + "src/functions.php" + ], + "psr-4": { + "DI\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "The dependency injection container for humans", + "homepage": "https://php-di.org/", + "keywords": [ + "PSR-11", + "container", + "container-interop", + "dependency injection", + "di", + "ioc", + "psr11" + ], + "support": { + "issues": "https://github.com/PHP-DI/PHP-DI/issues", + "source": "https://github.com/PHP-DI/PHP-DI/tree/6.4.0" + }, + "funding": [ + { + "url": "https://github.com/mnapoli", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/php-di/php-di", + "type": "tidelift" + } + ], + "time": "2022-04-09T16:46:38+00:00" + }, + { + "name": "php-di/phpdoc-reader", + "version": "2.2.1", + "source": { + "type": "git", + "url": "https://github.com/PHP-DI/PhpDocReader.git", + "reference": "66daff34cbd2627740ffec9469ffbac9f8c8185c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/PHP-DI/PhpDocReader/zipball/66daff34cbd2627740ffec9469ffbac9f8c8185c", + "reference": "66daff34cbd2627740ffec9469ffbac9f8c8185c", + "shasum": "" + }, + "require": { + "php": ">=7.2.0" + }, + "require-dev": { + "mnapoli/hard-mode": "~0.3.0", + "phpunit/phpunit": "^8.5|^9.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "PhpDocReader\\": "src/PhpDocReader" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "PhpDocReader parses @var and @param values in PHP docblocks (supports namespaced class names with the same resolution rules as PHP)", + "keywords": [ + "phpdoc", + "reflection" + ], + "support": { + "issues": "https://github.com/PHP-DI/PhpDocReader/issues", + "source": "https://github.com/PHP-DI/PhpDocReader/tree/2.2.1" + }, + "time": "2020-10-12T12:39:22+00:00" + }, + { + "name": "psr/container", + "version": "1.1.2", + "source": { + "type": "git", + "url": "https://github.com/php-fig/container.git", + "reference": "513e0666f7216c7459170d56df27dfcefe1689ea" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/container/zipball/513e0666f7216c7459170d56df27dfcefe1689ea", + "reference": "513e0666f7216c7459170d56df27dfcefe1689ea", + "shasum": "" + }, + "require": { + "php": ">=7.4.0" + }, + "type": "library", + "autoload": { + "psr-4": { + "Psr\\Container\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common Container Interface (PHP FIG PSR-11)", + "homepage": "https://github.com/php-fig/container", + "keywords": [ + "PSR-11", + "container", + "container-interface", + "container-interop", + "psr" + ], + "support": { + "issues": "https://github.com/php-fig/container/issues", + "source": "https://github.com/php-fig/container/tree/1.1.2" + }, + "time": "2021-11-05T16:50:12+00:00" + }, + { + "name": "psr/http-factory", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-factory.git", + "reference": "12ac7fcd07e5b077433f5f2bee95b3a771bf61be" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-factory/zipball/12ac7fcd07e5b077433f5f2bee95b3a771bf61be", + "reference": "12ac7fcd07e5b077433f5f2bee95b3a771bf61be", + "shasum": "" + }, + "require": { + "php": ">=7.0.0", + "psr/http-message": "^1.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Message\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interfaces for PSR-7 HTTP message factories", + "keywords": [ + "factory", + "http", + "message", + "psr", + "psr-17", + "psr-7", + "request", + "response" + ], + "support": { + "source": "https://github.com/php-fig/http-factory/tree/master" + }, + "time": "2019-04-30T12:38:16+00:00" + }, + { + "name": "psr/http-message", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-message.git", + "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-message/zipball/f6561bf28d520154e4b0ec72be95418abe6d9363", + "reference": "f6561bf28d520154e4b0ec72be95418abe6d9363", + "shasum": "" + }, + "require": { + "php": ">=5.3.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Message\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interface for HTTP messages", + "homepage": "https://github.com/php-fig/http-message", + "keywords": [ + "http", + "http-message", + "psr", + "psr-7", + "request", + "response" + ], + "support": { + "source": "https://github.com/php-fig/http-message/tree/master" + }, + "time": "2016-08-06T14:39:51+00:00" + }, + { + "name": "psr/http-server-handler", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-server-handler.git", + "reference": "aff2f80e33b7f026ec96bb42f63242dc50ffcae7" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-server-handler/zipball/aff2f80e33b7f026ec96bb42f63242dc50ffcae7", + "reference": "aff2f80e33b7f026ec96bb42f63242dc50ffcae7", + "shasum": "" + }, + "require": { + "php": ">=7.0", + "psr/http-message": "^1.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Server\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interface for HTTP server-side request handler", + "keywords": [ + "handler", + "http", + "http-interop", + "psr", + "psr-15", + "psr-7", + "request", + "response", + "server" + ], + "support": { + "issues": "https://github.com/php-fig/http-server-handler/issues", + "source": "https://github.com/php-fig/http-server-handler/tree/master" + }, + "time": "2018-10-30T16:46:14+00:00" + }, + { + "name": "psr/http-server-middleware", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/php-fig/http-server-middleware.git", + "reference": "2296f45510945530b9dceb8bcedb5cb84d40c5f5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/http-server-middleware/zipball/2296f45510945530b9dceb8bcedb5cb84d40c5f5", + "reference": "2296f45510945530b9dceb8bcedb5cb84d40c5f5", + "shasum": "" + }, + "require": { + "php": ">=7.0", + "psr/http-message": "^1.0", + "psr/http-server-handler": "^1.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Server\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "description": "Common interface for HTTP server-side middleware", + "keywords": [ + "http", + "http-interop", + "middleware", + "psr", + "psr-15", + "psr-7", + "request", + "response" + ], + "support": { + "issues": "https://github.com/php-fig/http-server-middleware/issues", + "source": "https://github.com/php-fig/http-server-middleware/tree/master" + }, + "time": "2018-10-30T17:12:04+00:00" + }, + { + "name": "psr/log", + "version": "1.1.4", + "source": { + "type": "git", + "url": "https://github.com/php-fig/log.git", + "reference": "d49695b909c3b7628b6289db5479a1c204601f11" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/php-fig/log/zipball/d49695b909c3b7628b6289db5479a1c204601f11", + "reference": "d49695b909c3b7628b6289db5479a1c204601f11", + "shasum": "" + }, + "require": { + "php": ">=5.3.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Psr\\Log\\": "Psr/Log/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "PHP-FIG", + "homepage": "https://www.php-fig.org/" + } + ], + "description": "Common interface for logging libraries", + "homepage": "https://github.com/php-fig/log", + "keywords": [ + "log", + "psr", + "psr-3" + ], + "support": { + "source": "https://github.com/php-fig/log/tree/1.1.4" + }, + "time": "2021-05-03T11:20:27+00:00" + }, + { + "name": "ralouphie/getallheaders", + "version": "3.0.3", + "source": { + "type": "git", + "url": "https://github.com/ralouphie/getallheaders.git", + "reference": "120b605dfeb996808c31b6477290a714d356e822" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/ralouphie/getallheaders/zipball/120b605dfeb996808c31b6477290a714d356e822", + "reference": "120b605dfeb996808c31b6477290a714d356e822", + "shasum": "" + }, + "require": { + "php": ">=5.6" + }, + "require-dev": { + "php-coveralls/php-coveralls": "^2.1", + "phpunit/phpunit": "^5 || ^6.5" + }, + "type": "library", + "autoload": { + "files": [ + "src/getallheaders.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ralph Khattar", + "email": "ralph.khattar@gmail.com" + } + ], + "description": "A polyfill for getallheaders.", + "support": { + "issues": "https://github.com/ralouphie/getallheaders/issues", + "source": "https://github.com/ralouphie/getallheaders/tree/develop" + }, + "time": "2019-03-08T08:55:37+00:00" + }, + { + "name": "slim/psr7", + "version": "1.5", + "source": { + "type": "git", + "url": "https://github.com/slimphp/Slim-Psr7.git", + "reference": "a47b43a8da7c0208b4c228af0cb29ea36080635a" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/slimphp/Slim-Psr7/zipball/a47b43a8da7c0208b4c228af0cb29ea36080635a", + "reference": "a47b43a8da7c0208b4c228af0cb29ea36080635a", + "shasum": "" + }, + "require": { + "fig/http-message-util": "^1.1.5", + "php": "^7.3 || ^8.0", + "psr/http-factory": "^1.0", + "psr/http-message": "^1.0", + "ralouphie/getallheaders": "^3.0", + "symfony/polyfill-php80": "^1.23" + }, + "provide": { + "psr/http-factory-implementation": "1.0", + "psr/http-message-implementation": "1.0" + }, + "require-dev": { + "adriansuter/php-autoload-override": "^1.2", + "ext-json": "*", + "http-interop/http-factory-tests": "^0.9.0", + "php-http/psr7-integration-tests": "dev-master", + "phpspec/prophecy": "^1.14", + "phpspec/prophecy-phpunit": "^2.0", + "phpstan/phpstan": "^0.12.99", + "phpunit/phpunit": "^9.5", + "squizlabs/php_codesniffer": "^3.6" + }, + "type": "library", + "autoload": { + "psr-4": { + "Slim\\Psr7\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Josh Lockhart", + "email": "hello@joshlockhart.com", + "homepage": "http://joshlockhart.com" + }, + { + "name": "Andrew Smith", + "email": "a.smith@silentworks.co.uk", + "homepage": "http://silentworks.co.uk" + }, + { + "name": "Rob Allen", + "email": "rob@akrabat.com", + "homepage": "http://akrabat.com" + }, + { + "name": "Pierre Berube", + "email": "pierre@lgse.com", + "homepage": "http://www.lgse.com" + } + ], + "description": "Strict PSR-7 implementation", + "homepage": "https://www.slimframework.com", + "keywords": [ + "http", + "psr-7", + "psr7" + ], + "support": { + "issues": "https://github.com/slimphp/Slim-Psr7/issues", + "source": "https://github.com/slimphp/Slim-Psr7/tree/1.5" + }, + "time": "2021-09-22T04:33:00+00:00" + }, + { + "name": "slim/slim", + "version": "4.10.0", + "source": { + "type": "git", + "url": "https://github.com/slimphp/Slim.git", + "reference": "0dfc7d2fdf2553b361d864d51af3fe8a6ad168b0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/slimphp/Slim/zipball/0dfc7d2fdf2553b361d864d51af3fe8a6ad168b0", + "reference": "0dfc7d2fdf2553b361d864d51af3fe8a6ad168b0", + "shasum": "" + }, + "require": { + "ext-json": "*", + "nikic/fast-route": "^1.3", + "php": "^7.4 || ^8.0", + "psr/container": "^1.0 || ^2.0", + "psr/http-factory": "^1.0", + "psr/http-message": "^1.0", + "psr/http-server-handler": "^1.0", + "psr/http-server-middleware": "^1.0", + "psr/log": "^1.1 || ^2.0 || ^3.0" + }, + "require-dev": { + "adriansuter/php-autoload-override": "^1.2", + "ext-simplexml": "*", + "guzzlehttp/psr7": "^2.1", + "httpsoft/http-message": "^1.0", + "httpsoft/http-server-request": "^1.0", + "laminas/laminas-diactoros": "^2.8", + "nyholm/psr7": "^1.5", + "nyholm/psr7-server": "^1.0", + "phpspec/prophecy": "^1.15", + "phpspec/prophecy-phpunit": "^2.0", + "phpstan/phpstan": "^1.4", + "phpunit/phpunit": "^9.5", + "slim/http": "^1.2", + "slim/psr7": "^1.5", + "squizlabs/php_codesniffer": "^3.6" + }, + "suggest": { + "ext-simplexml": "Needed to support XML format in BodyParsingMiddleware", + "ext-xml": "Needed to support XML format in BodyParsingMiddleware", + "php-di/php-di": "PHP-DI is the recommended container library to be used with Slim", + "slim/psr7": "Slim PSR-7 implementation. See https://www.slimframework.com/docs/v4/start/installation.html for more information." + }, + "type": "library", + "autoload": { + "psr-4": { + "Slim\\": "Slim" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Josh Lockhart", + "email": "hello@joshlockhart.com", + "homepage": "https://joshlockhart.com" + }, + { + "name": "Andrew Smith", + "email": "a.smith@silentworks.co.uk", + "homepage": "http://silentworks.co.uk" + }, + { + "name": "Rob Allen", + "email": "rob@akrabat.com", + "homepage": "http://akrabat.com" + }, + { + "name": "Pierre Berube", + "email": "pierre@lgse.com", + "homepage": "http://www.lgse.com" + }, + { + "name": "Gabriel Manricks", + "email": "gmanricks@me.com", + "homepage": "http://gabrielmanricks.com" + } + ], + "description": "Slim is a PHP micro framework that helps you quickly write simple yet powerful web applications and APIs", + "homepage": "https://www.slimframework.com", + "keywords": [ + "api", + "framework", + "micro", + "router" + ], + "support": { + "docs": "https://www.slimframework.com/docs/v4/", + "forum": "https://discourse.slimframework.com/", + "irc": "irc://irc.freenode.net:6667/slimphp", + "issues": "https://github.com/slimphp/Slim/issues", + "rss": "https://www.slimframework.com/blog/feed.rss", + "slack": "https://slimphp.slack.com/", + "source": "https://github.com/slimphp/Slim", + "wiki": "https://github.com/slimphp/Slim/wiki" + }, + "funding": [ + { + "url": "https://opencollective.com/slimphp", + "type": "open_collective" + }, + { + "url": "https://tidelift.com/funding/github/packagist/slim/slim", + "type": "tidelift" + } + ], + "time": "2022-03-14T14:18:23+00:00" + }, + { + "name": "symfony/polyfill-php80", + "version": "v1.26.0", + "source": { + "type": "git", + "url": "https://github.com/symfony/polyfill-php80.git", + "reference": "cfa0ae98841b9e461207c13ab093d76b0fa7bace" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/cfa0ae98841b9e461207c13ab093d76b0fa7bace", + "reference": "cfa0ae98841b9e461207c13ab093d76b0fa7bace", + "shasum": "" + }, + "require": { + "php": ">=7.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-main": "1.26-dev" + }, + "thanks": { + "name": "symfony/polyfill", + "url": "https://github.com/symfony/polyfill" + } + }, + "autoload": { + "files": [ + "bootstrap.php" + ], + "psr-4": { + "Symfony\\Polyfill\\Php80\\": "" + }, + "classmap": [ + "Resources/stubs" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Ion Bazan", + "email": "ion.bazan@gmail.com" + }, + { + "name": "Nicolas Grekas", + "email": "p@tchwork.com" + }, + { + "name": "Symfony Community", + "homepage": "https://symfony.com/contributors" + } + ], + "description": "Symfony polyfill backporting some PHP 8.0+ features to lower PHP versions", + "homepage": "https://symfony.com", + "keywords": [ + "compatibility", + "polyfill", + "portable", + "shim" + ], + "support": { + "source": "https://github.com/symfony/polyfill-php80/tree/v1.26.0" + }, + "funding": [ + { + "url": "https://symfony.com/sponsor", + "type": "custom" + }, + { + "url": "https://github.com/fabpot", + "type": "github" + }, + { + "url": "https://tidelift.com/funding/github/packagist/symfony/symfony", + "type": "tidelift" + } + ], + "time": "2022-05-10T07:21:04+00:00" + } + ], + "packages-dev": [ + { + "name": "doctrine/instantiator", + "version": "1.4.1", + "source": { + "type": "git", + "url": "https://github.com/doctrine/instantiator.git", + "reference": "10dcfce151b967d20fde1b34ae6640712c3891bc" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/doctrine/instantiator/zipball/10dcfce151b967d20fde1b34ae6640712c3891bc", + "reference": "10dcfce151b967d20fde1b34ae6640712c3891bc", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "require-dev": { + "doctrine/coding-standard": "^9", + "ext-pdo": "*", + "ext-phar": "*", + "phpbench/phpbench": "^0.16 || ^1", + "phpstan/phpstan": "^1.4", + "phpstan/phpstan-phpunit": "^1", + "phpunit/phpunit": "^7.5 || ^8.5 || ^9.5", + "vimeo/psalm": "^4.22" + }, + "type": "library", + "autoload": { + "psr-4": { + "Doctrine\\Instantiator\\": "src/Doctrine/Instantiator/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Marco Pivetta", + "email": "ocramius@gmail.com", + "homepage": "https://ocramius.github.io/" + } + ], + "description": "A small, lightweight utility to instantiate objects in PHP without invoking their constructors", + "homepage": "https://www.doctrine-project.org/projects/instantiator.html", + "keywords": [ + "constructor", + "instantiate" + ], + "support": { + "issues": "https://github.com/doctrine/instantiator/issues", + "source": "https://github.com/doctrine/instantiator/tree/1.4.1" + }, + "funding": [ + { + "url": "https://www.doctrine-project.org/sponsorship.html", + "type": "custom" + }, + { + "url": "https://www.patreon.com/phpdoctrine", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finstantiator", + "type": "tidelift" + } + ], + "time": "2022-03-03T08:28:38+00:00" + }, + { + "name": "jangregor/phpstan-prophecy", + "version": "1.0.0", + "source": { + "type": "git", + "url": "https://github.com/Jan0707/phpstan-prophecy.git", + "reference": "2bc7ca9460395690c6bf7332bdfb2f25d5cae8e0" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/Jan0707/phpstan-prophecy/zipball/2bc7ca9460395690c6bf7332bdfb2f25d5cae8e0", + "reference": "2bc7ca9460395690c6bf7332bdfb2f25d5cae8e0", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0", + "phpstan/phpstan": "^1.0.0" + }, + "conflict": { + "phpspec/prophecy": "<1.7.0,>=2.0.0", + "phpunit/phpunit": "<6.0.0,>=10.0.0" + }, + "require-dev": { + "ergebnis/composer-normalize": "^2.1.1", + "ergebnis/license": "^1.0.0", + "ergebnis/php-cs-fixer-config": "~2.2.0", + "phpspec/prophecy": "^1.7.0", + "phpunit/phpunit": "^6.0.0 || ^7.0.0 || ^8.0.0 || ^9.0.0" + }, + "type": "phpstan-extension", + "extra": { + "phpstan": { + "includes": [ + "extension.neon" + ] + } + }, + "autoload": { + "psr-4": { + "JanGregor\\Prophecy\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jan Gregor Emge-Triebel", + "email": "jan@jangregor.me" + } + ], + "description": "Provides a phpstan/phpstan extension for phpspec/prophecy", + "support": { + "issues": "https://github.com/Jan0707/phpstan-prophecy/issues", + "source": "https://github.com/Jan0707/phpstan-prophecy/tree/1.0.0" + }, + "funding": [ + { + "url": "https://github.com/localheinz", + "type": "github" + } + ], + "time": "2021-11-08T16:37:47+00:00" + }, + { + "name": "myclabs/deep-copy", + "version": "1.11.0", + "source": { + "type": "git", + "url": "https://github.com/myclabs/DeepCopy.git", + "reference": "14daed4296fae74d9e3201d2c4925d1acb7aa614" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/14daed4296fae74d9e3201d2c4925d1acb7aa614", + "reference": "14daed4296fae74d9e3201d2c4925d1acb7aa614", + "shasum": "" + }, + "require": { + "php": "^7.1 || ^8.0" + }, + "conflict": { + "doctrine/collections": "<1.6.8", + "doctrine/common": "<2.13.3 || >=3,<3.2.2" + }, + "require-dev": { + "doctrine/collections": "^1.6.8", + "doctrine/common": "^2.13.3 || ^3.2.2", + "phpunit/phpunit": "^7.5.20 || ^8.5.23 || ^9.5.13" + }, + "type": "library", + "autoload": { + "files": [ + "src/DeepCopy/deep_copy.php" + ], + "psr-4": { + "DeepCopy\\": "src/DeepCopy/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Create deep copies (clones) of your objects", + "keywords": [ + "clone", + "copy", + "duplicate", + "object", + "object graph" + ], + "support": { + "issues": "https://github.com/myclabs/DeepCopy/issues", + "source": "https://github.com/myclabs/DeepCopy/tree/1.11.0" + }, + "funding": [ + { + "url": "https://tidelift.com/funding/github/packagist/myclabs/deep-copy", + "type": "tidelift" + } + ], + "time": "2022-03-03T13:19:32+00:00" + }, + { + "name": "nikic/php-parser", + "version": "v4.14.0", + "source": { + "type": "git", + "url": "https://github.com/nikic/PHP-Parser.git", + "reference": "34bea19b6e03d8153165d8f30bba4c3be86184c1" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/34bea19b6e03d8153165d8f30bba4c3be86184c1", + "reference": "34bea19b6e03d8153165d8f30bba4c3be86184c1", + "shasum": "" + }, + "require": { + "ext-tokenizer": "*", + "php": ">=7.0" + }, + "require-dev": { + "ircmaxell/php-yacc": "^0.0.7", + "phpunit/phpunit": "^6.5 || ^7.0 || ^8.0 || ^9.0" + }, + "bin": [ + "bin/php-parse" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.9-dev" + } + }, + "autoload": { + "psr-4": { + "PhpParser\\": "lib/PhpParser" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Nikita Popov" + } + ], + "description": "A PHP parser written in PHP", + "keywords": [ + "parser", + "php" + ], + "support": { + "issues": "https://github.com/nikic/PHP-Parser/issues", + "source": "https://github.com/nikic/PHP-Parser/tree/v4.14.0" + }, + "time": "2022-05-31T20:59:12+00:00" + }, + { + "name": "phar-io/manifest", + "version": "2.0.3", + "source": { + "type": "git", + "url": "https://github.com/phar-io/manifest.git", + "reference": "97803eca37d319dfa7826cc2437fc020857acb53" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phar-io/manifest/zipball/97803eca37d319dfa7826cc2437fc020857acb53", + "reference": "97803eca37d319dfa7826cc2437fc020857acb53", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-phar": "*", + "ext-xmlwriter": "*", + "phar-io/version": "^3.0.1", + "php": "^7.2 || ^8.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0.x-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + }, + { + "name": "Sebastian Heuer", + "email": "sebastian@phpeople.de", + "role": "Developer" + }, + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "Developer" + } + ], + "description": "Component for reading phar.io manifest information from a PHP Archive (PHAR)", + "support": { + "issues": "https://github.com/phar-io/manifest/issues", + "source": "https://github.com/phar-io/manifest/tree/2.0.3" + }, + "time": "2021-07-20T11:28:43+00:00" + }, + { + "name": "phar-io/version", + "version": "3.2.1", + "source": { + "type": "git", + "url": "https://github.com/phar-io/version.git", + "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phar-io/version/zipball/4f7fd7836c6f332bb2933569e566a0d6c4cbed74", + "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "type": "library", + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + }, + { + "name": "Sebastian Heuer", + "email": "sebastian@phpeople.de", + "role": "Developer" + }, + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "Developer" + } + ], + "description": "Library for handling version information and constraints", + "support": { + "issues": "https://github.com/phar-io/version/issues", + "source": "https://github.com/phar-io/version/tree/3.2.1" + }, + "time": "2022-02-21T01:04:05+00:00" + }, + { + "name": "phpdocumentor/reflection-common", + "version": "2.2.0", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/ReflectionCommon.git", + "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b", + "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-2.x": "2.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Jaap van Otterdijk", + "email": "opensource@ijaap.nl" + } + ], + "description": "Common reflection classes used by phpdocumentor to reflect the code structure", + "homepage": "http://www.phpdoc.org", + "keywords": [ + "FQSEN", + "phpDocumentor", + "phpdoc", + "reflection", + "static analysis" + ], + "support": { + "issues": "https://github.com/phpDocumentor/ReflectionCommon/issues", + "source": "https://github.com/phpDocumentor/ReflectionCommon/tree/2.x" + }, + "time": "2020-06-27T09:03:43+00:00" + }, + { + "name": "phpdocumentor/reflection-docblock", + "version": "5.3.0", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/ReflectionDocBlock.git", + "reference": "622548b623e81ca6d78b721c5e029f4ce664f170" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/ReflectionDocBlock/zipball/622548b623e81ca6d78b721c5e029f4ce664f170", + "reference": "622548b623e81ca6d78b721c5e029f4ce664f170", + "shasum": "" + }, + "require": { + "ext-filter": "*", + "php": "^7.2 || ^8.0", + "phpdocumentor/reflection-common": "^2.2", + "phpdocumentor/type-resolver": "^1.3", + "webmozart/assert": "^1.9.1" + }, + "require-dev": { + "mockery/mockery": "~1.3.2", + "psalm/phar": "^4.8" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Mike van Riel", + "email": "me@mikevanriel.com" + }, + { + "name": "Jaap van Otterdijk", + "email": "account@ijaap.nl" + } + ], + "description": "With this component, a library can provide support for annotations via DocBlocks or otherwise retrieve information that is embedded in a DocBlock.", + "support": { + "issues": "https://github.com/phpDocumentor/ReflectionDocBlock/issues", + "source": "https://github.com/phpDocumentor/ReflectionDocBlock/tree/5.3.0" + }, + "time": "2021-10-19T17:43:47+00:00" + }, + { + "name": "phpdocumentor/type-resolver", + "version": "1.6.1", + "source": { + "type": "git", + "url": "https://github.com/phpDocumentor/TypeResolver.git", + "reference": "77a32518733312af16a44300404e945338981de3" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/77a32518733312af16a44300404e945338981de3", + "reference": "77a32518733312af16a44300404e945338981de3", + "shasum": "" + }, + "require": { + "php": "^7.2 || ^8.0", + "phpdocumentor/reflection-common": "^2.0" + }, + "require-dev": { + "ext-tokenizer": "*", + "psalm/phar": "^4.8" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-1.x": "1.x-dev" + } + }, + "autoload": { + "psr-4": { + "phpDocumentor\\Reflection\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Mike van Riel", + "email": "me@mikevanriel.com" + } + ], + "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names", + "support": { + "issues": "https://github.com/phpDocumentor/TypeResolver/issues", + "source": "https://github.com/phpDocumentor/TypeResolver/tree/1.6.1" + }, + "time": "2022-03-15T21:29:03+00:00" + }, + { + "name": "phpspec/prophecy", + "version": "v1.15.0", + "source": { + "type": "git", + "url": "https://github.com/phpspec/prophecy.git", + "reference": "bbcd7380b0ebf3961ee21409db7b38bc31d69a13" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpspec/prophecy/zipball/bbcd7380b0ebf3961ee21409db7b38bc31d69a13", + "reference": "bbcd7380b0ebf3961ee21409db7b38bc31d69a13", + "shasum": "" + }, + "require": { + "doctrine/instantiator": "^1.2", + "php": "^7.2 || ~8.0, <8.2", + "phpdocumentor/reflection-docblock": "^5.2", + "sebastian/comparator": "^3.0 || ^4.0", + "sebastian/recursion-context": "^3.0 || ^4.0" + }, + "require-dev": { + "phpspec/phpspec": "^6.0 || ^7.0", + "phpunit/phpunit": "^8.0 || ^9.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.x-dev" + } + }, + "autoload": { + "psr-4": { + "Prophecy\\": "src/Prophecy" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Konstantin Kudryashov", + "email": "ever.zet@gmail.com", + "homepage": "http://everzet.com" + }, + { + "name": "Marcello Duarte", + "email": "marcello.duarte@gmail.com" + } + ], + "description": "Highly opinionated mocking framework for PHP 5.3+", + "homepage": "https://github.com/phpspec/prophecy", + "keywords": [ + "Double", + "Dummy", + "fake", + "mock", + "spy", + "stub" + ], + "support": { + "issues": "https://github.com/phpspec/prophecy/issues", + "source": "https://github.com/phpspec/prophecy/tree/v1.15.0" + }, + "time": "2021-12-08T12:19:24+00:00" + }, + { + "name": "phpspec/prophecy-phpunit", + "version": "v2.0.1", + "source": { + "type": "git", + "url": "https://github.com/phpspec/prophecy-phpunit.git", + "reference": "2d7a9df55f257d2cba9b1d0c0963a54960657177" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpspec/prophecy-phpunit/zipball/2d7a9df55f257d2cba9b1d0c0963a54960657177", + "reference": "2d7a9df55f257d2cba9b1d0c0963a54960657177", + "shasum": "" + }, + "require": { + "php": "^7.3 || ^8", + "phpspec/prophecy": "^1.3", + "phpunit/phpunit": "^9.1" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "psr-4": { + "Prophecy\\PhpUnit\\": "src" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Christophe Coevoet", + "email": "stof@notk.org" + } + ], + "description": "Integrating the Prophecy mocking library in PHPUnit test cases", + "homepage": "http://phpspec.net", + "keywords": [ + "phpunit", + "prophecy" + ], + "support": { + "issues": "https://github.com/phpspec/prophecy-phpunit/issues", + "source": "https://github.com/phpspec/prophecy-phpunit/tree/v2.0.1" + }, + "time": "2020-07-09T08:33:42+00:00" + }, + { + "name": "phpstan/extension-installer", + "version": "1.1.0", + "source": { + "type": "git", + "url": "https://github.com/phpstan/extension-installer.git", + "reference": "66c7adc9dfa38b6b5838a9fb728b68a7d8348051" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpstan/extension-installer/zipball/66c7adc9dfa38b6b5838a9fb728b68a7d8348051", + "reference": "66c7adc9dfa38b6b5838a9fb728b68a7d8348051", + "shasum": "" + }, + "require": { + "composer-plugin-api": "^1.1 || ^2.0", + "php": "^7.1 || ^8.0", + "phpstan/phpstan": ">=0.11.6" + }, + "require-dev": { + "composer/composer": "^1.8", + "phing/phing": "^2.16.3", + "php-parallel-lint/php-parallel-lint": "^1.2.0", + "phpstan/phpstan-strict-rules": "^0.11 || ^0.12" + }, + "type": "composer-plugin", + "extra": { + "class": "PHPStan\\ExtensionInstaller\\Plugin" + }, + "autoload": { + "psr-4": { + "PHPStan\\ExtensionInstaller\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "Composer plugin for automatic installation of PHPStan extensions", + "support": { + "issues": "https://github.com/phpstan/extension-installer/issues", + "source": "https://github.com/phpstan/extension-installer/tree/1.1.0" + }, + "time": "2020-12-13T13:06:13+00:00" + }, + { + "name": "phpstan/phpstan", + "version": "1.8.0", + "source": { + "type": "git", + "url": "https://github.com/phpstan/phpstan.git", + "reference": "b7648d4ee9321665acaf112e49da9fd93df8fbd5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/phpstan/phpstan/zipball/b7648d4ee9321665acaf112e49da9fd93df8fbd5", + "reference": "b7648d4ee9321665acaf112e49da9fd93df8fbd5", + "shasum": "" + }, + "require": { + "php": "^7.2|^8.0" + }, + "conflict": { + "phpstan/phpstan-shim": "*" + }, + "bin": [ + "phpstan", + "phpstan.phar" + ], + "type": "library", + "autoload": { + "files": [ + "bootstrap.php" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "description": "PHPStan - PHP Static Analysis Tool", + "support": { + "issues": "https://github.com/phpstan/phpstan/issues", + "source": "https://github.com/phpstan/phpstan/tree/1.8.0" + }, + "funding": [ + { + "url": "https://github.com/ondrejmirtes", + "type": "github" + }, + { + "url": "https://github.com/phpstan", + "type": "github" + }, + { + "url": "https://www.patreon.com/phpstan", + "type": "patreon" + }, + { + "url": "https://tidelift.com/funding/github/packagist/phpstan/phpstan", + "type": "tidelift" + } + ], + "time": "2022-06-29T08:53:31+00:00" + }, + { + "name": "phpunit/php-code-coverage", + "version": "9.2.15", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-code-coverage.git", + "reference": "2e9da11878c4202f97915c1cb4bb1ca318a63f5f" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/2e9da11878c4202f97915c1cb4bb1ca318a63f5f", + "reference": "2e9da11878c4202f97915c1cb4bb1ca318a63f5f", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-libxml": "*", + "ext-xmlwriter": "*", + "nikic/php-parser": "^4.13.0", + "php": ">=7.3", + "phpunit/php-file-iterator": "^3.0.3", + "phpunit/php-text-template": "^2.0.2", + "sebastian/code-unit-reverse-lookup": "^2.0.2", + "sebastian/complexity": "^2.0", + "sebastian/environment": "^5.1.2", + "sebastian/lines-of-code": "^1.0.3", + "sebastian/version": "^3.0.1", + "theseer/tokenizer": "^1.2.0" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-pcov": "*", + "ext-xdebug": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "9.2-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.", + "homepage": "https://github.com/sebastianbergmann/php-code-coverage", + "keywords": [ + "coverage", + "testing", + "xunit" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-code-coverage/issues", + "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/9.2.15" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2022-03-07T09:28:20+00:00" + }, + { + "name": "phpunit/php-file-iterator", + "version": "3.0.6", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-file-iterator.git", + "reference": "cf1c2e7c203ac650e352f4cc675a7021e7d1b3cf" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/cf1c2e7c203ac650e352f4cc675a7021e7d1b3cf", + "reference": "cf1c2e7c203ac650e352f4cc675a7021e7d1b3cf", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "FilterIterator implementation that filters files based on a list of suffixes.", + "homepage": "https://github.com/sebastianbergmann/php-file-iterator/", + "keywords": [ + "filesystem", + "iterator" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-file-iterator/issues", + "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/3.0.6" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2021-12-02T12:48:52+00:00" + }, + { + "name": "phpunit/php-invoker", + "version": "3.1.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-invoker.git", + "reference": "5a10147d0aaf65b58940a0b72f71c9ac0423cc67" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/5a10147d0aaf65b58940a0b72f71c9ac0423cc67", + "reference": "5a10147d0aaf65b58940a0b72f71c9ac0423cc67", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "ext-pcntl": "*", + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-pcntl": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.1-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Invoke callables with a timeout", + "homepage": "https://github.com/sebastianbergmann/php-invoker/", + "keywords": [ + "process" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-invoker/issues", + "source": "https://github.com/sebastianbergmann/php-invoker/tree/3.1.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T05:58:55+00:00" + }, + { + "name": "phpunit/php-text-template", + "version": "2.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-text-template.git", + "reference": "5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28", + "reference": "5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Simple template engine.", + "homepage": "https://github.com/sebastianbergmann/php-text-template/", + "keywords": [ + "template" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-text-template/issues", + "source": "https://github.com/sebastianbergmann/php-text-template/tree/2.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T05:33:50+00:00" + }, + { + "name": "phpunit/php-timer", + "version": "5.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/php-timer.git", + "reference": "5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2", + "reference": "5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Utility class for timing", + "homepage": "https://github.com/sebastianbergmann/php-timer/", + "keywords": [ + "timer" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/php-timer/issues", + "source": "https://github.com/sebastianbergmann/php-timer/tree/5.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:16:10+00:00" + }, + { + "name": "phpunit/phpunit", + "version": "9.5.21", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/phpunit.git", + "reference": "0e32b76be457de00e83213528f6bb37e2a38fcb1" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/0e32b76be457de00e83213528f6bb37e2a38fcb1", + "reference": "0e32b76be457de00e83213528f6bb37e2a38fcb1", + "shasum": "" + }, + "require": { + "doctrine/instantiator": "^1.3.1", + "ext-dom": "*", + "ext-json": "*", + "ext-libxml": "*", + "ext-mbstring": "*", + "ext-xml": "*", + "ext-xmlwriter": "*", + "myclabs/deep-copy": "^1.10.1", + "phar-io/manifest": "^2.0.3", + "phar-io/version": "^3.0.2", + "php": ">=7.3", + "phpspec/prophecy": "^1.12.1", + "phpunit/php-code-coverage": "^9.2.13", + "phpunit/php-file-iterator": "^3.0.5", + "phpunit/php-invoker": "^3.1.1", + "phpunit/php-text-template": "^2.0.3", + "phpunit/php-timer": "^5.0.2", + "sebastian/cli-parser": "^1.0.1", + "sebastian/code-unit": "^1.0.6", + "sebastian/comparator": "^4.0.5", + "sebastian/diff": "^4.0.3", + "sebastian/environment": "^5.1.3", + "sebastian/exporter": "^4.0.3", + "sebastian/global-state": "^5.0.1", + "sebastian/object-enumerator": "^4.0.3", + "sebastian/resource-operations": "^3.0.3", + "sebastian/type": "^3.0", + "sebastian/version": "^3.0.2" + }, + "require-dev": { + "phpspec/prophecy-phpunit": "^2.0.1" + }, + "suggest": { + "ext-soap": "*", + "ext-xdebug": "*" + }, + "bin": [ + "phpunit" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "9.5-dev" + } + }, + "autoload": { + "files": [ + "src/Framework/Assert/Functions.php" + ], + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "The PHP Unit Testing framework.", + "homepage": "https://phpunit.de/", + "keywords": [ + "phpunit", + "testing", + "xunit" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/phpunit/issues", + "source": "https://github.com/sebastianbergmann/phpunit/tree/9.5.21" + }, + "funding": [ + { + "url": "https://phpunit.de/sponsors.html", + "type": "custom" + }, + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2022-06-19T12:14:25+00:00" + }, + { + "name": "sebastian/cli-parser", + "version": "1.0.1", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/cli-parser.git", + "reference": "442e7c7e687e42adc03470c7b668bc4b2402c0b2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/442e7c7e687e42adc03470c7b668bc4b2402c0b2", + "reference": "442e7c7e687e42adc03470c7b668bc4b2402c0b2", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for parsing CLI options", + "homepage": "https://github.com/sebastianbergmann/cli-parser", + "support": { + "issues": "https://github.com/sebastianbergmann/cli-parser/issues", + "source": "https://github.com/sebastianbergmann/cli-parser/tree/1.0.1" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T06:08:49+00:00" + }, + { + "name": "sebastian/code-unit", + "version": "1.0.8", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/code-unit.git", + "reference": "1fc9f64c0927627ef78ba436c9b17d967e68e120" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/1fc9f64c0927627ef78ba436c9b17d967e68e120", + "reference": "1fc9f64c0927627ef78ba436c9b17d967e68e120", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Collection of value objects that represent the PHP code units", + "homepage": "https://github.com/sebastianbergmann/code-unit", + "support": { + "issues": "https://github.com/sebastianbergmann/code-unit/issues", + "source": "https://github.com/sebastianbergmann/code-unit/tree/1.0.8" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:08:54+00:00" + }, + { + "name": "sebastian/code-unit-reverse-lookup", + "version": "2.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git", + "reference": "ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5", + "reference": "ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Looks up which function or method a line of code belongs to", + "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/", + "support": { + "issues": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/issues", + "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/2.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T05:30:19+00:00" + }, + { + "name": "sebastian/comparator", + "version": "4.0.6", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/comparator.git", + "reference": "55f4261989e546dc112258c7a75935a81a7ce382" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/55f4261989e546dc112258c7a75935a81a7ce382", + "reference": "55f4261989e546dc112258c7a75935a81a7ce382", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/diff": "^4.0", + "sebastian/exporter": "^4.0" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Volker Dusch", + "email": "github@wallbash.com" + }, + { + "name": "Bernhard Schussek", + "email": "bschussek@2bepublished.at" + } + ], + "description": "Provides the functionality to compare PHP values for equality", + "homepage": "https://github.com/sebastianbergmann/comparator", + "keywords": [ + "comparator", + "compare", + "equality" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/comparator/issues", + "source": "https://github.com/sebastianbergmann/comparator/tree/4.0.6" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T15:49:45+00:00" + }, + { + "name": "sebastian/complexity", + "version": "2.0.2", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/complexity.git", + "reference": "739b35e53379900cc9ac327b2147867b8b6efd88" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/739b35e53379900cc9ac327b2147867b8b6efd88", + "reference": "739b35e53379900cc9ac327b2147867b8b6efd88", + "shasum": "" + }, + "require": { + "nikic/php-parser": "^4.7", + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for calculating the complexity of PHP code units", + "homepage": "https://github.com/sebastianbergmann/complexity", + "support": { + "issues": "https://github.com/sebastianbergmann/complexity/issues", + "source": "https://github.com/sebastianbergmann/complexity/tree/2.0.2" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T15:52:27+00:00" + }, + { + "name": "sebastian/diff", + "version": "4.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/diff.git", + "reference": "3461e3fccc7cfdfc2720be910d3bd73c69be590d" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/3461e3fccc7cfdfc2720be910d3bd73c69be590d", + "reference": "3461e3fccc7cfdfc2720be910d3bd73c69be590d", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3", + "symfony/process": "^4.2 || ^5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Kore Nordmann", + "email": "mail@kore-nordmann.de" + } + ], + "description": "Diff implementation", + "homepage": "https://github.com/sebastianbergmann/diff", + "keywords": [ + "diff", + "udiff", + "unidiff", + "unified diff" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/diff/issues", + "source": "https://github.com/sebastianbergmann/diff/tree/4.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:10:38+00:00" + }, + { + "name": "sebastian/environment", + "version": "5.1.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/environment.git", + "reference": "1b5dff7bb151a4db11d49d90e5408e4e938270f7" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/1b5dff7bb151a4db11d49d90e5408e4e938270f7", + "reference": "1b5dff7bb151a4db11d49d90e5408e4e938270f7", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-posix": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.1-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Provides functionality to handle HHVM/PHP environments", + "homepage": "http://www.github.com/sebastianbergmann/environment", + "keywords": [ + "Xdebug", + "environment", + "hhvm" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/environment/issues", + "source": "https://github.com/sebastianbergmann/environment/tree/5.1.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2022-04-03T09:37:03+00:00" + }, + { + "name": "sebastian/exporter", + "version": "4.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/exporter.git", + "reference": "65e8b7db476c5dd267e65eea9cab77584d3cfff9" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/65e8b7db476c5dd267e65eea9cab77584d3cfff9", + "reference": "65e8b7db476c5dd267e65eea9cab77584d3cfff9", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/recursion-context": "^4.0" + }, + "require-dev": { + "ext-mbstring": "*", + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Volker Dusch", + "email": "github@wallbash.com" + }, + { + "name": "Adam Harvey", + "email": "aharvey@php.net" + }, + { + "name": "Bernhard Schussek", + "email": "bschussek@gmail.com" + } + ], + "description": "Provides the functionality to export PHP variables for visualization", + "homepage": "https://www.github.com/sebastianbergmann/exporter", + "keywords": [ + "export", + "exporter" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/exporter/issues", + "source": "https://github.com/sebastianbergmann/exporter/tree/4.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2021-11-11T14:18:36+00:00" + }, + { + "name": "sebastian/global-state", + "version": "5.0.5", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/global-state.git", + "reference": "0ca8db5a5fc9c8646244e629625ac486fa286bf2" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/0ca8db5a5fc9c8646244e629625ac486fa286bf2", + "reference": "0ca8db5a5fc9c8646244e629625ac486fa286bf2", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/object-reflector": "^2.0", + "sebastian/recursion-context": "^4.0" + }, + "require-dev": { + "ext-dom": "*", + "phpunit/phpunit": "^9.3" + }, + "suggest": { + "ext-uopz": "*" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "5.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Snapshotting of global state", + "homepage": "http://www.github.com/sebastianbergmann/global-state", + "keywords": [ + "global state" + ], + "support": { + "issues": "https://github.com/sebastianbergmann/global-state/issues", + "source": "https://github.com/sebastianbergmann/global-state/tree/5.0.5" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2022-02-14T08:28:10+00:00" + }, + { + "name": "sebastian/lines-of-code", + "version": "1.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/lines-of-code.git", + "reference": "c1c2e997aa3146983ed888ad08b15470a2e22ecc" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/c1c2e997aa3146983ed888ad08b15470a2e22ecc", + "reference": "c1c2e997aa3146983ed888ad08b15470a2e22ecc", + "shasum": "" + }, + "require": { + "nikic/php-parser": "^4.6", + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library for counting the lines of code in PHP source code", + "homepage": "https://github.com/sebastianbergmann/lines-of-code", + "support": { + "issues": "https://github.com/sebastianbergmann/lines-of-code/issues", + "source": "https://github.com/sebastianbergmann/lines-of-code/tree/1.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-11-28T06:42:11+00:00" + }, + { + "name": "sebastian/object-enumerator", + "version": "4.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/object-enumerator.git", + "reference": "5c9eeac41b290a3712d88851518825ad78f45c71" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/5c9eeac41b290a3712d88851518825ad78f45c71", + "reference": "5c9eeac41b290a3712d88851518825ad78f45c71", + "shasum": "" + }, + "require": { + "php": ">=7.3", + "sebastian/object-reflector": "^2.0", + "sebastian/recursion-context": "^4.0" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Traverses array structures and object graphs to enumerate all referenced objects", + "homepage": "https://github.com/sebastianbergmann/object-enumerator/", + "support": { + "issues": "https://github.com/sebastianbergmann/object-enumerator/issues", + "source": "https://github.com/sebastianbergmann/object-enumerator/tree/4.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:12:34+00:00" + }, + { + "name": "sebastian/object-reflector", + "version": "2.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/object-reflector.git", + "reference": "b4f479ebdbf63ac605d183ece17d8d7fe49c15c7" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/b4f479ebdbf63ac605d183ece17d8d7fe49c15c7", + "reference": "b4f479ebdbf63ac605d183ece17d8d7fe49c15c7", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "2.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Allows reflection of object attributes, including inherited and non-public ones", + "homepage": "https://github.com/sebastianbergmann/object-reflector/", + "support": { + "issues": "https://github.com/sebastianbergmann/object-reflector/issues", + "source": "https://github.com/sebastianbergmann/object-reflector/tree/2.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:14:26+00:00" + }, + { + "name": "sebastian/recursion-context", + "version": "4.0.4", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/recursion-context.git", + "reference": "cd9d8cf3c5804de4341c283ed787f099f5506172" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/cd9d8cf3c5804de4341c283ed787f099f5506172", + "reference": "cd9d8cf3c5804de4341c283ed787f099f5506172", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "4.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + }, + { + "name": "Jeff Welch", + "email": "whatthejeff@gmail.com" + }, + { + "name": "Adam Harvey", + "email": "aharvey@php.net" + } + ], + "description": "Provides functionality to recursively process PHP variables", + "homepage": "http://www.github.com/sebastianbergmann/recursion-context", + "support": { + "issues": "https://github.com/sebastianbergmann/recursion-context/issues", + "source": "https://github.com/sebastianbergmann/recursion-context/tree/4.0.4" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-10-26T13:17:30+00:00" + }, + { + "name": "sebastian/resource-operations", + "version": "3.0.3", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/resource-operations.git", + "reference": "0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/resource-operations/zipball/0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8", + "reference": "0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.0" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de" + } + ], + "description": "Provides a list of PHP built-in functions that operate on resources", + "homepage": "https://www.github.com/sebastianbergmann/resource-operations", + "support": { + "issues": "https://github.com/sebastianbergmann/resource-operations/issues", + "source": "https://github.com/sebastianbergmann/resource-operations/tree/3.0.3" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T06:45:17+00:00" + }, + { + "name": "sebastian/type", + "version": "3.0.0", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/type.git", + "reference": "b233b84bc4465aff7b57cf1c4bc75c86d00d6dad" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/b233b84bc4465aff7b57cf1c4bc75c86d00d6dad", + "reference": "b233b84bc4465aff7b57cf1c4bc75c86d00d6dad", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "require-dev": { + "phpunit/phpunit": "^9.5" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Collection of value objects that represent the types of the PHP type system", + "homepage": "https://github.com/sebastianbergmann/type", + "support": { + "issues": "https://github.com/sebastianbergmann/type/issues", + "source": "https://github.com/sebastianbergmann/type/tree/3.0.0" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2022-03-15T09:54:48+00:00" + }, + { + "name": "sebastian/version", + "version": "3.0.2", + "source": { + "type": "git", + "url": "https://github.com/sebastianbergmann/version.git", + "reference": "c6c1022351a901512170118436c764e473f6de8c" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c6c1022351a901512170118436c764e473f6de8c", + "reference": "c6c1022351a901512170118436c764e473f6de8c", + "shasum": "" + }, + "require": { + "php": ">=7.3" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.0-dev" + } + }, + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Sebastian Bergmann", + "email": "sebastian@phpunit.de", + "role": "lead" + } + ], + "description": "Library that helps with managing the version number of Git-hosted PHP projects", + "homepage": "https://github.com/sebastianbergmann/version", + "support": { + "issues": "https://github.com/sebastianbergmann/version/issues", + "source": "https://github.com/sebastianbergmann/version/tree/3.0.2" + }, + "funding": [ + { + "url": "https://github.com/sebastianbergmann", + "type": "github" + } + ], + "time": "2020-09-28T06:39:44+00:00" + }, + { + "name": "squizlabs/php_codesniffer", + "version": "3.7.1", + "source": { + "type": "git", + "url": "https://github.com/squizlabs/PHP_CodeSniffer.git", + "reference": "1359e176e9307e906dc3d890bcc9603ff6d90619" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/squizlabs/PHP_CodeSniffer/zipball/1359e176e9307e906dc3d890bcc9603ff6d90619", + "reference": "1359e176e9307e906dc3d890bcc9603ff6d90619", + "shasum": "" + }, + "require": { + "ext-simplexml": "*", + "ext-tokenizer": "*", + "ext-xmlwriter": "*", + "php": ">=5.4.0" + }, + "require-dev": { + "phpunit/phpunit": "^4.0 || ^5.0 || ^6.0 || ^7.0" + }, + "bin": [ + "bin/phpcs", + "bin/phpcbf" + ], + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "3.x-dev" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Greg Sherwood", + "role": "lead" + } + ], + "description": "PHP_CodeSniffer tokenizes PHP, JavaScript and CSS files and detects violations of a defined set of coding standards.", + "homepage": "https://github.com/squizlabs/PHP_CodeSniffer", + "keywords": [ + "phpcs", + "standards" + ], + "support": { + "issues": "https://github.com/squizlabs/PHP_CodeSniffer/issues", + "source": "https://github.com/squizlabs/PHP_CodeSniffer", + "wiki": "https://github.com/squizlabs/PHP_CodeSniffer/wiki" + }, + "time": "2022-06-18T07:21:10+00:00" + }, + { + "name": "theseer/tokenizer", + "version": "1.2.1", + "source": { + "type": "git", + "url": "https://github.com/theseer/tokenizer.git", + "reference": "34a41e998c2183e22995f158c581e7b5e755ab9e" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/theseer/tokenizer/zipball/34a41e998c2183e22995f158c581e7b5e755ab9e", + "reference": "34a41e998c2183e22995f158c581e7b5e755ab9e", + "shasum": "" + }, + "require": { + "ext-dom": "*", + "ext-tokenizer": "*", + "ext-xmlwriter": "*", + "php": "^7.2 || ^8.0" + }, + "type": "library", + "autoload": { + "classmap": [ + "src/" + ] + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "BSD-3-Clause" + ], + "authors": [ + { + "name": "Arne Blankerts", + "email": "arne@blankerts.de", + "role": "Developer" + } + ], + "description": "A small library for converting tokenized PHP source code into XML and potentially other formats", + "support": { + "issues": "https://github.com/theseer/tokenizer/issues", + "source": "https://github.com/theseer/tokenizer/tree/1.2.1" + }, + "funding": [ + { + "url": "https://github.com/theseer", + "type": "github" + } + ], + "time": "2021-07-28T10:34:58+00:00" + }, + { + "name": "webmozart/assert", + "version": "1.11.0", + "source": { + "type": "git", + "url": "https://github.com/webmozarts/assert.git", + "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991" + }, + "dist": { + "type": "zip", + "url": "https://api.github.com/repos/webmozarts/assert/zipball/11cb2199493b2f8a3b53e7f19068fc6aac760991", + "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991", + "shasum": "" + }, + "require": { + "ext-ctype": "*", + "php": "^7.2 || ^8.0" + }, + "conflict": { + "phpstan/phpstan": "<0.12.20", + "vimeo/psalm": "<4.6.1 || 4.6.2" + }, + "require-dev": { + "phpunit/phpunit": "^8.5.13" + }, + "type": "library", + "extra": { + "branch-alias": { + "dev-master": "1.10-dev" + } + }, + "autoload": { + "psr-4": { + "Webmozart\\Assert\\": "src/" + } + }, + "notification-url": "https://packagist.org/downloads/", + "license": [ + "MIT" + ], + "authors": [ + { + "name": "Bernhard Schussek", + "email": "bschussek@gmail.com" + } + ], + "description": "Assertions to validate method input/output with nice error messages.", + "keywords": [ + "assert", + "check", + "validate" + ], + "support": { + "issues": "https://github.com/webmozarts/assert/issues", + "source": "https://github.com/webmozarts/assert/tree/1.11.0" + }, + "time": "2022-06-03T18:03:27+00:00" + } + ], + "aliases": [], + "minimum-stability": "stable", + "stability-flags": [], + "prefer-stable": false, + "prefer-lowest": false, + "platform": { + "php": "^7.4 || ^8.0", + "ext-json": "*" + }, + "platform-dev": [], + "plugin-api-version": "2.0.0" +} diff --git a/logs/README.md b/logs/README.md new file mode 100644 index 0000000..d4a602e --- /dev/null +++ b/logs/README.md @@ -0,0 +1 @@ +Your Slim Framework application's log files will be written to this directory. diff --git a/phpcs.xml b/phpcs.xml new file mode 100644 index 0000000..72e9907 --- /dev/null +++ b/phpcs.xml @@ -0,0 +1,17 @@ + + + Slim coding standard + + + + + + + + + + + + src + tests + \ No newline at end of file diff --git a/phpstan.neon.dist b/phpstan.neon.dist new file mode 100644 index 0000000..2e09595 --- /dev/null +++ b/phpstan.neon.dist @@ -0,0 +1,4 @@ +parameters: + level: 4 + paths: + - src diff --git a/phpunit.xml b/phpunit.xml new file mode 100644 index 0000000..f830400 --- /dev/null +++ b/phpunit.xml @@ -0,0 +1,27 @@ + + + + ./tests/ + + + + + ./src/ + + + diff --git a/public/.htaccess b/public/.htaccess new file mode 100644 index 0000000..fe74ec5 --- /dev/null +++ b/public/.htaccess @@ -0,0 +1,34 @@ +Options All -Indexes + + +order allow,deny +deny from all + + + + RewriteEngine On + + # Redirect to HTTPS + # RewriteEngine On + # RewriteCond %{HTTPS} off + # RewriteRule ^(.*)$ https://%{HTTP_HOST}%{REQUEST_URI} [L,R=301] + + # Some hosts may require you to use the `RewriteBase` directive. + # Determine the RewriteBase automatically and set it as environment variable. + # If you are using Apache aliases to do mass virtual hosting or installed the + # project in a subdirectory, the base path will be prepended to allow proper + # resolution of the index.php file and to redirect to the correct URI. It will + # work in environments without path prefix as well, providing a safe, one-size + # fits all solution. But as you do not need it in this case, you can comment + # the following 2 lines to eliminate the overhead. + RewriteCond %{REQUEST_URI}::$1 ^(/.+)/(.*)::\2$ + RewriteRule ^(.*) - [E=BASE:%1] + + # If the above doesn't work you might need to set the `RewriteBase` directive manually, it should be the + # absolute physical path to the directory that contains this htaccess file. + # RewriteBase / + + RewriteCond %{REQUEST_FILENAME} !-d + RewriteCond %{REQUEST_FILENAME} !-f + RewriteRule ^ index.php [QSA,L] + diff --git a/public/index.php b/public/index.php new file mode 100644 index 0000000..55178cf --- /dev/null +++ b/public/index.php @@ -0,0 +1,81 @@ +enableCompilation(__DIR__ . '/../var/cache'); +} + +// Set up settings +$settings = require __DIR__ . '/../app/settings.php'; +$settings($containerBuilder); + +// Set up dependencies +$dependencies = require __DIR__ . '/../app/dependencies.php'; +$dependencies($containerBuilder); + +// Set up repositories +$repositories = require __DIR__ . '/../app/repositories.php'; +$repositories($containerBuilder); + +// Build PHP-DI Container instance +$container = $containerBuilder->build(); + +// Instantiate the app +AppFactory::setContainer($container); +$app = AppFactory::create(); +$callableResolver = $app->getCallableResolver(); + +// Register middleware +$middleware = require __DIR__ . '/../app/middleware.php'; +$middleware($app); + +// Register routes +$routes = require __DIR__ . '/../app/routes.php'; +$routes($app); + +/** @var SettingsInterface $settings */ +$settings = $container->get(SettingsInterface::class); + +$displayErrorDetails = $settings->get('displayErrorDetails'); +$logError = $settings->get('logError'); +$logErrorDetails = $settings->get('logErrorDetails'); + +// Create Request object from globals +$serverRequestCreator = ServerRequestCreatorFactory::create(); +$request = $serverRequestCreator->createServerRequestFromGlobals(); + +// Create Error Handler +$responseFactory = $app->getResponseFactory(); +$errorHandler = new HttpErrorHandler($callableResolver, $responseFactory); + +// Create Shutdown Handler +$shutdownHandler = new ShutdownHandler($request, $errorHandler, $displayErrorDetails); +register_shutdown_function($shutdownHandler); + +// Add Routing Middleware +$app->addRoutingMiddleware(); + +// Add Body Parsing Middleware +$app->addBodyParsingMiddleware(); + +// Add Error Middleware +$errorMiddleware = $app->addErrorMiddleware($displayErrorDetails, $logError, $logErrorDetails); +$errorMiddleware->setDefaultErrorHandler($errorHandler); + +// Run App & Emit Response +$response = $app->handle($request); +$responseEmitter = new ResponseEmitter(); +$responseEmitter->emit($response); diff --git a/src/Application/Actions/Action.php b/src/Application/Actions/Action.php new file mode 100644 index 0000000..5073750 --- /dev/null +++ b/src/Application/Actions/Action.php @@ -0,0 +1,91 @@ +logger = $logger; + } + + /** + * @throws HttpNotFoundException + * @throws HttpBadRequestException + */ + public function __invoke(Request $request, Response $response, array $args): Response + { + $this->request = $request; + $this->response = $response; + $this->args = $args; + + try { + return $this->action(); + } catch (DomainRecordNotFoundException $e) { + throw new HttpNotFoundException($this->request, $e->getMessage()); + } + } + + /** + * @throws DomainRecordNotFoundException + * @throws HttpBadRequestException + */ + abstract protected function action(): Response; + + /** + * @return array|object + */ + protected function getFormData() + { + return $this->request->getParsedBody(); + } + + /** + * @return mixed + * @throws HttpBadRequestException + */ + protected function resolveArg(string $name) + { + if (!isset($this->args[$name])) { + throw new HttpBadRequestException($this->request, "Could not resolve argument `{$name}`."); + } + + return $this->args[$name]; + } + + /** + * @param array|object|null $data + */ + protected function respondWithData($data = null, int $statusCode = 200): Response + { + $payload = new ActionPayload($statusCode, $data); + + return $this->respond($payload); + } + + protected function respond(ActionPayload $payload): Response + { + $json = json_encode($payload, JSON_PRETTY_PRINT); + $this->response->getBody()->write($json); + + return $this->response + ->withHeader('Content-Type', 'application/json') + ->withStatus($payload->getStatusCode()); + } +} diff --git a/src/Application/Actions/ActionError.php b/src/Application/Actions/ActionError.php new file mode 100644 index 0000000..61fe5d4 --- /dev/null +++ b/src/Application/Actions/ActionError.php @@ -0,0 +1,62 @@ +type = $type; + $this->description = $description; + } + + public function getType(): string + { + return $this->type; + } + + public function setType(string $type): self + { + $this->type = $type; + return $this; + } + + public function getDescription(): string + { + return $this->description; + } + + public function setDescription(?string $description = null): self + { + $this->description = $description; + return $this; + } + + #[\ReturnTypeWillChange] + public function jsonSerialize(): array + { + $payload = [ + 'type' => $this->type, + 'description' => $this->description, + ]; + + return $payload; + } +} diff --git a/src/Application/Actions/ActionPayload.php b/src/Application/Actions/ActionPayload.php new file mode 100644 index 0000000..8bbadbf --- /dev/null +++ b/src/Application/Actions/ActionPayload.php @@ -0,0 +1,62 @@ +statusCode = $statusCode; + $this->data = $data; + $this->error = $error; + } + + public function getStatusCode(): int + { + return $this->statusCode; + } + + /** + * @return array|null|object + */ + public function getData() + { + return $this->data; + } + + public function getError(): ?ActionError + { + return $this->error; + } + + #[\ReturnTypeWillChange] + public function jsonSerialize(): array + { + $payload = [ + 'statusCode' => $this->statusCode, + ]; + + if ($this->data !== null) { + $payload['data'] = $this->data; + } elseif ($this->error !== null) { + $payload['error'] = $this->error; + } + + return $payload; + } +} diff --git a/src/Application/Actions/User/ListUsersAction.php b/src/Application/Actions/User/ListUsersAction.php new file mode 100644 index 0000000..21b4750 --- /dev/null +++ b/src/Application/Actions/User/ListUsersAction.php @@ -0,0 +1,21 @@ +userRepository->findAll(); + + $this->logger->info("Users list was viewed."); + + return $this->respondWithData($users); + } +} diff --git a/src/Application/Actions/User/UserAction.php b/src/Application/Actions/User/UserAction.php new file mode 100644 index 0000000..9125b44 --- /dev/null +++ b/src/Application/Actions/User/UserAction.php @@ -0,0 +1,19 @@ +userRepository = $userRepository; + } +} diff --git a/src/Application/Actions/User/ViewUserAction.php b/src/Application/Actions/User/ViewUserAction.php new file mode 100644 index 0000000..519d5fa --- /dev/null +++ b/src/Application/Actions/User/ViewUserAction.php @@ -0,0 +1,22 @@ +resolveArg('id'); + $user = $this->userRepository->findUserOfId($userId); + + $this->logger->info("User of id `${userId}` was viewed."); + + return $this->respondWithData($user); + } +} diff --git a/src/Application/Handlers/HttpErrorHandler.php b/src/Application/Handlers/HttpErrorHandler.php new file mode 100644 index 0000000..257153c --- /dev/null +++ b/src/Application/Handlers/HttpErrorHandler.php @@ -0,0 +1,68 @@ +exception; + $statusCode = 500; + $error = new ActionError( + ActionError::SERVER_ERROR, + 'An internal error has occurred while processing your request.' + ); + + if ($exception instanceof HttpException) { + $statusCode = $exception->getCode(); + $error->setDescription($exception->getMessage()); + + if ($exception instanceof HttpNotFoundException) { + $error->setType(ActionError::RESOURCE_NOT_FOUND); + } elseif ($exception instanceof HttpMethodNotAllowedException) { + $error->setType(ActionError::NOT_ALLOWED); + } elseif ($exception instanceof HttpUnauthorizedException) { + $error->setType(ActionError::UNAUTHENTICATED); + } elseif ($exception instanceof HttpForbiddenException) { + $error->setType(ActionError::INSUFFICIENT_PRIVILEGES); + } elseif ($exception instanceof HttpBadRequestException) { + $error->setType(ActionError::BAD_REQUEST); + } elseif ($exception instanceof HttpNotImplementedException) { + $error->setType(ActionError::NOT_IMPLEMENTED); + } + } + + if (!($exception instanceof HttpException) + && $exception instanceof Throwable + && $this->displayErrorDetails + ) { + $error->setDescription($exception->getMessage()); + } + + $payload = new ActionPayload($statusCode, null, $error); + $encodedPayload = json_encode($payload, JSON_PRETTY_PRINT); + + $response = $this->responseFactory->createResponse($statusCode); + $response->getBody()->write($encodedPayload); + + return $response->withHeader('Content-Type', 'application/json'); + } +} diff --git a/src/Application/Handlers/ShutdownHandler.php b/src/Application/Handlers/ShutdownHandler.php new file mode 100644 index 0000000..8bdbaa8 --- /dev/null +++ b/src/Application/Handlers/ShutdownHandler.php @@ -0,0 +1,73 @@ +request = $request; + $this->errorHandler = $errorHandler; + $this->displayErrorDetails = $displayErrorDetails; + } + + public function __invoke() + { + $error = error_get_last(); + if ($error) { + $errorFile = $error['file']; + $errorLine = $error['line']; + $errorMessage = $error['message']; + $errorType = $error['type']; + $message = 'An error while processing your request. Please try again later.'; + + if ($this->displayErrorDetails) { + switch ($errorType) { + case E_USER_ERROR: + $message = "FATAL ERROR: {$errorMessage}. "; + $message .= " on line {$errorLine} in file {$errorFile}."; + break; + + case E_USER_WARNING: + $message = "WARNING: {$errorMessage}"; + break; + + case E_USER_NOTICE: + $message = "NOTICE: {$errorMessage}"; + break; + + default: + $message = "ERROR: {$errorMessage}"; + $message .= " on line {$errorLine} in file {$errorFile}."; + break; + } + } + + $exception = new HttpInternalServerErrorException($this->request, $message); + $response = $this->errorHandler->__invoke( + $this->request, + $exception, + $this->displayErrorDetails, + false, + false, + ); + + $responseEmitter = new ResponseEmitter(); + $responseEmitter->emit($response); + } + } +} diff --git a/src/Application/Middleware/SessionMiddleware.php b/src/Application/Middleware/SessionMiddleware.php new file mode 100644 index 0000000..cbfc1d6 --- /dev/null +++ b/src/Application/Middleware/SessionMiddleware.php @@ -0,0 +1,25 @@ +withAttribute('session', $_SESSION); + } + + return $handler->handle($request); + } +} diff --git a/src/Application/ResponseEmitter/ResponseEmitter.php b/src/Application/ResponseEmitter/ResponseEmitter.php new file mode 100644 index 0000000..e9688e7 --- /dev/null +++ b/src/Application/ResponseEmitter/ResponseEmitter.php @@ -0,0 +1,37 @@ +withHeader('Access-Control-Allow-Credentials', 'true') + ->withHeader('Access-Control-Allow-Origin', $origin) + ->withHeader( + 'Access-Control-Allow-Headers', + 'X-Requested-With, Content-Type, Accept, Origin, Authorization', + ) + ->withHeader('Access-Control-Allow-Methods', 'GET, POST, PUT, PATCH, DELETE, OPTIONS') + ->withHeader('Cache-Control', 'no-store, no-cache, must-revalidate, max-age=0') + ->withAddedHeader('Cache-Control', 'post-check=0, pre-check=0') + ->withHeader('Pragma', 'no-cache'); + + if (ob_get_contents()) { + ob_clean(); + } + + parent::emit($response); + } +} diff --git a/src/Application/Settings/Settings.php b/src/Application/Settings/Settings.php new file mode 100644 index 0000000..d0efaff --- /dev/null +++ b/src/Application/Settings/Settings.php @@ -0,0 +1,22 @@ +settings = $settings; + } + + /** + * @return mixed + */ + public function get(string $key = '') + { + return (empty($key)) ? $this->settings : $this->settings[$key]; + } +} diff --git a/src/Application/Settings/SettingsInterface.php b/src/Application/Settings/SettingsInterface.php new file mode 100644 index 0000000..cfe3e3f --- /dev/null +++ b/src/Application/Settings/SettingsInterface.php @@ -0,0 +1,13 @@ +id = $id; + $this->username = strtolower($username); + $this->firstName = ucfirst($firstName); + $this->lastName = ucfirst($lastName); + } + + public function getId(): ?int + { + return $this->id; + } + + public function getUsername(): string + { + return $this->username; + } + + public function getFirstName(): string + { + return $this->firstName; + } + + public function getLastName(): string + { + return $this->lastName; + } + + #[\ReturnTypeWillChange] + public function jsonSerialize(): array + { + return [ + 'id' => $this->id, + 'username' => $this->username, + 'firstName' => $this->firstName, + 'lastName' => $this->lastName, + ]; + } +} diff --git a/src/Domain/User/UserNotFoundException.php b/src/Domain/User/UserNotFoundException.php new file mode 100644 index 0000000..2080774 --- /dev/null +++ b/src/Domain/User/UserNotFoundException.php @@ -0,0 +1,11 @@ +users = $users ?? [ + 1 => new User(1, 'bill.gates', 'Bill', 'Gates'), + 2 => new User(2, 'steve.jobs', 'Steve', 'Jobs'), + 3 => new User(3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'), + 4 => new User(4, 'evan.spiegel', 'Evan', 'Spiegel'), + 5 => new User(5, 'jack.dorsey', 'Jack', 'Dorsey'), + ]; + } + + /** + * {@inheritdoc} + */ + public function findAll(): array + { + return array_values($this->users); + } + + /** + * {@inheritdoc} + */ + public function findUserOfId(int $id): User + { + if (!isset($this->users[$id])) { + throw new UserNotFoundException(); + } + + return $this->users[$id]; + } +} diff --git a/tests/Application/Actions/ActionTest.php b/tests/Application/Actions/ActionTest.php new file mode 100644 index 0000000..874d3ca --- /dev/null +++ b/tests/Application/Actions/ActionTest.php @@ -0,0 +1,78 @@ +getAppInstance(); + $container = $app->getContainer(); + $logger = $container->get(LoggerInterface::class); + + $testAction = new class($logger) extends Action { + public function __construct( + LoggerInterface $loggerInterface + ) { + parent::__construct($loggerInterface); + } + + public function action(): Response + { + return $this->respond( + new ActionPayload( + 202, + [ + 'willBeDoneAt' => (new DateTimeImmutable())->format(DateTimeImmutable::ATOM) + ] + ) + ); + } + }; + + $app->get('/test-action-response-code', $testAction); + $request = $this->createRequest('GET', '/test-action-response-code'); + $response = $app->handle($request); + + $this->assertEquals(202, $response->getStatusCode()); + } + + public function testActionSetsHttpCodeRespondData() + { + $app = $this->getAppInstance(); + $container = $app->getContainer(); + $logger = $container->get(LoggerInterface::class); + + $testAction = new class($logger) extends Action { + public function __construct( + LoggerInterface $loggerInterface + ) { + parent::__construct($loggerInterface); + } + + public function action(): Response + { + return $this->respondWithData( + [ + 'willBeDoneAt' => (new DateTimeImmutable())->format(DateTimeImmutable::ATOM) + ], + 202 + ); + } + }; + + $app->get('/test-action-response-code', $testAction); + $request = $this->createRequest('GET', '/test-action-response-code'); + $response = $app->handle($request); + + $this->assertEquals(202, $response->getStatusCode()); + } +} diff --git a/tests/Application/Actions/User/ListUserActionTest.php b/tests/Application/Actions/User/ListUserActionTest.php new file mode 100644 index 0000000..f2d79c8 --- /dev/null +++ b/tests/Application/Actions/User/ListUserActionTest.php @@ -0,0 +1,40 @@ +getAppInstance(); + + /** @var Container $container */ + $container = $app->getContainer(); + + $user = new User(1, 'bill.gates', 'Bill', 'Gates'); + + $userRepositoryProphecy = $this->prophesize(UserRepository::class); + $userRepositoryProphecy + ->findAll() + ->willReturn([$user]) + ->shouldBeCalledOnce(); + + $container->set(UserRepository::class, $userRepositoryProphecy->reveal()); + + $request = $this->createRequest('GET', '/users'); + $response = $app->handle($request); + + $payload = (string) $response->getBody(); + $expectedPayload = new ActionPayload(200, [$user]); + $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT); + + $this->assertEquals($serializedPayload, $payload); + } +} diff --git a/tests/Application/Actions/User/ViewUserActionTest.php b/tests/Application/Actions/User/ViewUserActionTest.php new file mode 100644 index 0000000..b2bcf8f --- /dev/null +++ b/tests/Application/Actions/User/ViewUserActionTest.php @@ -0,0 +1,79 @@ +getAppInstance(); + + /** @var Container $container */ + $container = $app->getContainer(); + + $user = new User(1, 'bill.gates', 'Bill', 'Gates'); + + $userRepositoryProphecy = $this->prophesize(UserRepository::class); + $userRepositoryProphecy + ->findUserOfId(1) + ->willReturn($user) + ->shouldBeCalledOnce(); + + $container->set(UserRepository::class, $userRepositoryProphecy->reveal()); + + $request = $this->createRequest('GET', '/users/1'); + $response = $app->handle($request); + + $payload = (string) $response->getBody(); + $expectedPayload = new ActionPayload(200, $user); + $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT); + + $this->assertEquals($serializedPayload, $payload); + } + + public function testActionThrowsUserNotFoundException() + { + $app = $this->getAppInstance(); + + $callableResolver = $app->getCallableResolver(); + $responseFactory = $app->getResponseFactory(); + + $errorHandler = new HttpErrorHandler($callableResolver, $responseFactory); + $errorMiddleware = new ErrorMiddleware($callableResolver, $responseFactory, true, false, false); + $errorMiddleware->setDefaultErrorHandler($errorHandler); + + $app->add($errorMiddleware); + + /** @var Container $container */ + $container = $app->getContainer(); + + $userRepositoryProphecy = $this->prophesize(UserRepository::class); + $userRepositoryProphecy + ->findUserOfId(1) + ->willThrow(new UserNotFoundException()) + ->shouldBeCalledOnce(); + + $container->set(UserRepository::class, $userRepositoryProphecy->reveal()); + + $request = $this->createRequest('GET', '/users/1'); + $response = $app->handle($request); + + $payload = (string) $response->getBody(); + $expectedError = new ActionError(ActionError::RESOURCE_NOT_FOUND, 'The user you requested does not exist.'); + $expectedPayload = new ActionPayload(404, null, $expectedError); + $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT); + + $this->assertEquals($serializedPayload, $payload); + } +} diff --git a/tests/Domain/User/UserTest.php b/tests/Domain/User/UserTest.php new file mode 100644 index 0000000..03746b1 --- /dev/null +++ b/tests/Domain/User/UserTest.php @@ -0,0 +1,59 @@ +assertEquals($id, $user->getId()); + $this->assertEquals($username, $user->getUsername()); + $this->assertEquals($firstName, $user->getFirstName()); + $this->assertEquals($lastName, $user->getLastName()); + } + + /** + * @dataProvider userProvider + * @param int $id + * @param string $username + * @param string $firstName + * @param string $lastName + */ + public function testJsonSerialize(int $id, string $username, string $firstName, string $lastName) + { + $user = new User($id, $username, $firstName, $lastName); + + $expectedPayload = json_encode([ + 'id' => $id, + 'username' => $username, + 'firstName' => $firstName, + 'lastName' => $lastName, + ]); + + $this->assertEquals($expectedPayload, json_encode($user)); + } +} diff --git a/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php b/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php new file mode 100644 index 0000000..f82af6d --- /dev/null +++ b/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php @@ -0,0 +1,52 @@ + $user]); + + $this->assertEquals([$user], $userRepository->findAll()); + } + + public function testFindAllUsersByDefault() + { + $users = [ + 1 => new User(1, 'bill.gates', 'Bill', 'Gates'), + 2 => new User(2, 'steve.jobs', 'Steve', 'Jobs'), + 3 => new User(3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'), + 4 => new User(4, 'evan.spiegel', 'Evan', 'Spiegel'), + 5 => new User(5, 'jack.dorsey', 'Jack', 'Dorsey'), + ]; + + $userRepository = new InMemoryUserRepository(); + + $this->assertEquals(array_values($users), $userRepository->findAll()); + } + + public function testFindUserOfId() + { + $user = new User(1, 'bill.gates', 'Bill', 'Gates'); + + $userRepository = new InMemoryUserRepository([1 => $user]); + + $this->assertEquals($user, $userRepository->findUserOfId(1)); + } + + public function testFindUserOfIdThrowsNotFoundException() + { + $userRepository = new InMemoryUserRepository([]); + $this->expectException(UserNotFoundException::class); + $userRepository->findUserOfId(1); + } +} diff --git a/tests/TestCase.php b/tests/TestCase.php new file mode 100644 index 0000000..235c80c --- /dev/null +++ b/tests/TestCase.php @@ -0,0 +1,89 @@ +build(); + + // Instantiate the app + AppFactory::setContainer($container); + $app = AppFactory::create(); + + // Register middleware + $middleware = require __DIR__ . '/../app/middleware.php'; + $middleware($app); + + // Register routes + $routes = require __DIR__ . '/../app/routes.php'; + $routes($app); + + return $app; + } + + /** + * @param string $method + * @param string $path + * @param array $headers + * @param array $cookies + * @param array $serverParams + * @return Request + */ + protected function createRequest( + string $method, + string $path, + array $headers = ['HTTP_ACCEPT' => 'application/json'], + array $cookies = [], + array $serverParams = [] + ): Request { + $uri = new Uri('', '', 80, $path); + $handle = fopen('php://temp', 'w+'); + $stream = (new StreamFactory())->createStreamFromResource($handle); + + $h = new Headers(); + foreach ($headers as $name => $value) { + $h->addHeader($name, $value); + } + + return new SlimRequest($method, $uri, $h, $cookies, $serverParams, $stream); + } +} diff --git a/tests/bootstrap.php b/tests/bootstrap.php new file mode 100644 index 0000000..26a796a --- /dev/null +++ b/tests/bootstrap.php @@ -0,0 +1,2 @@ +